| Paroxetine | |
|---|---|
| Esters [] | |
|---|---|
| Paroxetine acetate | |
| Molecular structure via molpic based on CDK |
| Physical properties [] | |
|---|---|
| Molecular mass | 329.4 g/mol [1] |
| Melting point | 120-138 [1] |
| Boiling point | 451.7±45.0 [1] |
| Solubility | Odorless, off-white powder, mp 147-150 °C . Solubility in water: >1 g/mL/Paroxetine methanesulfonate/ [1] |
| Predicted LogP | 3.5 [1] |
| Structural Identifiers [] | |
|---|---|
| Molecular formula | C19H20FNO3 [1] |
| IUPAC name | (3S,4R)-3-(1,3-benzodioxol-5-yloxymethyl)-4-(4-fluorophenyl)piperidine [1] |
| SMILES | C1CNC[C@H]([C@@H]1C2=CC=C(C=C2)F)COC3=CC4=C(C=C3)OCO4 [1] |
| InChI | InChI=1S/C19H20FNO3/c20-15-3-1-13(2-4-15)17-7-8-21-10-14(17)11-22-16-5-6-18-19(9-16)24-12-23-18/h1-6,9,14,17,21H,7-8,10-12H2/t14-,17-/m0/s1 [1] |
| InChIKey | AHOUBRCZNHFOSL-YOEHRIQHSA-N [1] |
| Dosing[] |
|---|
| Oral [] | |
|---|---|
| Threshold | 1 - 10 |
| Light | 10 - 17.5 |
| Common | 17.5 - 20 |
| Strong | 20 - 30 |
| Heavy | 30 - 40 |
Statistically derived dosages via DBI-IGS We do not take any responsibility for medical complications or loss of life sustained by following these dosages blindly. |
Paroxetine
Paroxetine (also known as Frosinor, Casbol, Motivan, PaxPar, Paroxetina, Paxetil, Paroxetinum, Arketis, Besitram or Daparox) is a
Chemistry
Salts and Esters []
Paroxetine is typically found in the form of its mesylate, maleate, acetate and hydrochloride salts
or its acetate ester.
Stereochemistry []
Paroxetine is a absolute mixture