5-HTP | |
---|---|
Molecular structure via molpic based on CDK |
Conformer [] | |
---|---|
Physical properties [] | |
---|---|
Molecular mass | 220.22 g/mol [1] |
Appearance | Minute rods or needles from ethanol [1] |
Melting point | 298-300 °C (decomposes) [1] |
Solubility | Solubilities: 2.5 g/100 mL in 50% boiling alcohol; 5.5 g/100 mL in water at 100 °C [1] |
Predicted LogP | -1.2 [1] |
Structural Identifiers [] | |
---|---|
Molecular formula | C11H12N2O3 [1] |
IUPAC name | 2-amino-3-(5-hydroxy-1H-indol-3-yl)propanoic acid [1] |
SMILES | C1=CC2=C(C=C1O)C(=CN2)CC(C(=O)O)N [1] |
InChI | InChI=1S/C11H12N2O3/c12-9(11(15)16)3-6-5-13-10-2-1-7(14)4-8(6)10/h1-2,4-5,9,13-14H,3,12H2,(H,15,16) [1] |
InChIKey | LDCYZAJDBXYCGN-UHFFFAOYSA-N [1] |
Oxitriptan
Oxitriptan (also known as 5-hydroxytryptophan, 5-Hydroxy-DL-tryptophan, DL-5-Hydroxytryptophan, 114-03-4, 5-HTP, DL-Hydroxytryptophan, (+-)-5-Hydroxytryptophan, DL-5-HTP, 5-Hydroxytryptophan DL-form or 5-hydroxy tryptophan) is a
Chemistry
Stereochemistry []
(RS)-Oxitriptan is a racemic mixture of the optical stereoisomers
Anodyne Usernotes [] | |
---|---|
0xea / Oxitriptan via | seams to improve wellbeing after MDMA use |