Oxidopamine
| 6-OHDA | |
|---|---|
| Molecular structure via molpic based on CDK |
| Rotamer [] | |
|---|---|
| Conformer structure via JSmol |
| Physical properties [] | |
|---|---|
| Molecular mass | 169.18 g/mol [1] |
| Melting point | 232 °C [1] |
| Predicted LogP | 0.2 [1] |
| Structural Identifiers [] | |
|---|---|
| Molecular formula | C8H11NO3 [1] |
| IUPAC name | 5-(2-aminoethyl)benzene-1,2,4-triol [1] |
| SMILES | C1=C(C(=CC(=C1O)O)O)CCN [1] |
| InChI | InChI=1S/C8H11NO3/c9-2-1-5-3-7(11)8(12)4-6(5)10/h3-4,10-12H,1-2,9H2 [1] |
| InChIKey | DIVDFFZHCJEHGG-UHFFFAOYSA-N [1] |
Oxidopamine (also known as 6-Hydroxydopamine, Oxidopamina, 2,4,5-Trihydroxyphenethylamine, Oxidopaminum, Topamine, 1,2,4-Benzenetriol, 5-(2-aminoethyl)-, 5-(2-Aminoethyl)-1,2,4-benzenetriol, CCRIS 4342, 4-13-00-02916 or 6 Hydroxydopamine) is a neurotoxin substance of the catecholamine class.
Chemistry
Salts []
Oxidopamine is typically found in the form of its hydrobromide and hydrochloride salts.
Stereochemistry []
Oxidopamine is a achiral mixture