| Ondansetron | |
|---|---|
| Molecular structure via molpic based on CDK |
| Physical properties [] | |
|---|---|
| Molecular mass | 293.4 g/mol [1] |
| Appearance | Crystals from methanol [1] |
| Melting point | 231-232 °C [1] |
| Solubility | Sparingly soluble in water [1] |
| Predicted LogP | 2.3 [1] |
| Structural Identifiers [] | |
|---|---|
| Molecular formula | C18H19N3O [1] |
| IUPAC name | 9-methyl-3-[(2-methylimidazol-1-yl)methyl]-2,3-dihydro-1H-carbazol-4-one [1] |
| SMILES | CC1=NC=CN1CC2CCC3=C(C2=O)C4=CC=CC=C4N3C [1] |
| InChI | InChI=1S/C18H19N3O/c1-12-19-9-10-21(12)11-13-7-8-16-17(18(13)22)14-5-3-4-6-15(14)20(16)2/h3-6,9-10,13H,7-8,11H2,1-2H3 [1] |
| InChIKey | FELGMEQIXOGIFQ-UHFFFAOYSA-N [1] |
| Dosing[] |
|---|
| Oral [] | |
|---|---|
| Threshold | 1 - 2 |
| Light | ≤ 2 |
| Common | 2 - 4 |
| Strong | 4 |
| Heavy | 4 - 6 |
Statistically derived dosages via DBI-IGS We do not take any responsibility for medical complications or loss of life sustained by following these dosages blindly. |
Ondansetron
Ondansetron (also known as Zofran ODT, Zudan, Zuplenz, 116002-70-1, Ondansetron Injection, GR 38032X, GR 38032, A04AA01, EUR-1025 or 1,2,3,9-Tetrahydro-9-methyl-3-((2-methyl-1H-imidazol-1-yl)methyl)-4H-carbazol-4-one) is a
Chemistry
Salts []
Ondansetron is typically found in the form of its hydrochloride salt.
Stereochemistry []
(RS)-Ondansetron is a racemic mixture of the optical stereoisomers
Anodyne