Norepinephrine
| NE | |
|---|---|
| Molecular structure via molpic based on CDK |
| Rotamer [] | |
|---|---|
| Conformer structure via 3Dmol.js |
| Physical properties [] | |
|---|---|
| Molecular mass | 169.18 g/mol [1] |
| Predicted LogP | -1.2 [1] |
| Structural Identifiers [] | |
|---|---|
| Molecular formula | C8H11NO3 [1] |
| IUPAC name | 4-(2-amino-1-hydroxyethyl)benzene-1,2-diol [1] |
| SMILES | C1=CC(=C(C=C1C(CN)O)O)O [1] |
| InChI | InChI=1S/C8H11NO3/c9-4-8(12)5-1-2-6(10)7(11)3-5/h1-3,8,10-12H,4,9H2 [1] |
| InChIKey | SFLSHLFXELFNJZ-UHFFFAOYSA-N [1] |
Norepinephrine (also known as 1,2-Benzenediol, 4-(2-amino-1-hydroxyethyl)-, 586-17-4, 622-681-9, dl-Noradrenaline, dl-Norepinephrine, dl-Arterenol, (+/-)-noradrenaline, Levarterenol;L-Noradrenaline, [3H]NE or Noradrenalin, dl-) is a neurotransmitters substance of the phenylethanolamine and catecholamine class.
Chemistry
Salts []
Norepinephrine is typically found in the form of its bitartrate salt.
Stereochemistry []
(RS)-Norepinephrine is a racemic mixture of the optical stereoisomers.