| Neostigmine | |
|---|---|
| Molecular structure via molpic based on CDK |
| Physical properties [] | |
|---|---|
| Molecular mass | 223.29 g/mol [1] |
| Solubility | 6.77e-02 g/L [1] |
| Predicted LogP | 1.5 [1] |
| Structural Identifiers [] | |
|---|---|
| Molecular formula | C12H19N2O2+ [1] |
| IUPAC name | [3-(dimethylcarbamoyloxy)phenyl]-trimethylazanium [1] |
| SMILES | CN(C)C(=O)OC1=CC=CC(=C1)[N+](C)(C)C [1] |
| InChI | InChI=1S/C12H19N2O2/c1-13(2)12(15)16-11-8-6-7-10(9-11)14(3,4)5/h6-9H,1-5H3/q+1 [1] |
| InChIKey | ALWKGYPQUAPLQC-UHFFFAOYSA-N [1] |
| Pharmacokinetics[] | |
|---|---|
| Elimination half-life | 50–90 minutes |
| Duration of action | up to 4 hrs |
Neostigmine
Neostigmine (also known as Eustigmin, Eustigmine, Vagostigmine, Prostigmin, Juvastigmin, Neostigmin, Neostigminum, Intrastigmina, m-Trimethylammoniumphenyldimethylcarbamate or 3-Trimethylammoniumphenyl N,N-dimethylcarbamate)
Chemistry
Salts []
Neostigmine is typically found in the form of its mesylate salt.
Stereochemistry []
Neostigmine is a achiral mixture
Legal status
- Australia: Neostigmine is a S4 substance.
- United Kingdom: Neostigmine is a prescription only substance.
- United States: Neostigmine is a prescription only substance.