NALT | |
---|---|
Molecular structure via molpic based on CDK |
Rotamer [] | |
---|---|
Physical properties [] | |
---|---|
Molecular mass | 223.22 g/mol [1] |
Melting point | 149-152 [1] |
Boiling point | 530.00 to 533.00 °C. @ 760.00 mm Hg [1] |
Solubility | 297 mg/mL [1] |
Predicted LogP | -0.2 [1] |
Structural Identifiers [] | |
---|---|
Molecular formula | C11H13NO4 [1] |
IUPAC name | (2S)-2-acetamido-3-(4-hydroxyphenyl)propanoic acid [1] |
SMILES | CC(=O)N[C@@H](CC1=CC=C(C=C1)O)C(=O)O [1] |
InChI | InChI=1S/C11H13NO4/c1-7(13)12-10(11(15)16)6-8-2-4-9(14)5-3-8/h2-5,10,14H,6H2,1H3,(H,12,13)(H,15,16)/t10-/m0/s1 [1] |
InChIKey | CAHKINHBCWCHCF-JTQLQIEISA-N [1] |
N-Acetyl-L-tyrosine
N-Acetyl-L-tyrosine (also known as N-Acetyltyrosine, Acetyl tyrosine, TANOGEN HB, TYR-EXCEL, Acetyl l-tyrosine, Tyrosine, N-acetyl-, L-, N-acetyl-l-tyrosine, N-acetyltyrosine, (2S)-2-(acetylamino)-3-(4-hydroxyphenyl)propanoic acid or (2S)-2-Acetylamino-3-(4-hydroxyphenyl)propanoate) is a
Chemistry
Stereochemistry []
N-Acetyl-L-tyrosine is a absolute mixture
Anodyne Usernotes [] | |
---|---|
0xea / N-Acetyl-L-tyrosine via Oral and Intravenous | Mild adrenic activity 3000mg oral; injected 500mg intravenous; Corrosive |