Anodyne| Minoxidil | |
|---|---|
 | |
| Molecular structure via molpic based on CDK |
| Conformer [] | |
|---|---|
| Conformer structure via JSmol | |
| Physical properties [] | |
|---|---|
| Molecular mass | 209.25 g/mol [1] |
| Appearance | Crystals from methanol-acetonitrile [1] |
| Odor | Odorless [1] |
| Melting point | 248 °C [1] |
| Decomposition | When heated to decomposition it emits toxic fumes of /nitrogen oxides/. [1] |
| Solubility | >31.4 [ug/mL] (The mean of the results at pH 7.4) [1] |
| Predicted LogP | 1.2 [1] |
| Structural Identifiers [] | |
|---|---|
| Molecular formula | C9H15N5O [1] |
| IUPAC name | 3-hydroxy-2-imino-6-piperidin-1-ylpyrimidin-4-amine [1] |
| SMILES | C1CCN(CC1)C2=NC(=N)N(C(=C2)N)O [1] |
| InChI | InChI=1S/C9H15N5O/c10-7-6-8(12-9(11)14(7)15)13-4-2-1-3-5-13/h6,11,15H,1-5,10H2 [1] |
| InChIKey | ZIMGGGWCDYVHOY-UHFFFAOYSA-N [1] |
Minoxidil
Minoxidil (also known as Minoximen, Regaine, Theroxidil, Alopexil, Alostil, Tricoxidil, Lonolox, Normoxidil, Prexidil or Minodyl) is a
Chemistry
Salts []
Minoxidil is typically found in the form of its tartrate salt.
Stereochemistry []
Minoxidil is a achiral mixture
| Anodyne Usernotes [] | |
|---|---|
| 0xea / Minoxidil via Transdermal and Oral | Intense Vasodilation (promotes hair-regrowth) Intense Respiratory depression) at 10-15mg oral administration |
Legal status
- Australia: Minoxidil is a S4 substance.
- United Kingdom: Minoxidil is a GSL substance.
- United States: Minoxidil is a OTC substance.