Methylnaphthidate
| HDMP-28 | |
|---|---|
| Molecular structure via molpic based on CDK |
| Physical properties [] | |
|---|---|
| Molecular mass | 283.4 g/mol [1] |
| Predicted LogP | 1.5 [1] |
| Structural Identifiers [] | |
|---|---|
| Molecular formula | C18H21NO2 [1] |
| IUPAC name | methyl (2R)-2-naphthalen-2-yl-2-[(2R)-piperidin-2-yl]acetate [1] |
| SMILES | COC(=O)C(C1CCCCN1)C2=CC3=CC=CC=C3C=C2 [1] |
| InChI | InChI=1S/C18H21NO2/c1-21-18(20)17(16-8-4-5-11-19-16)15-10-9-13-6-2-3-7-14(13)12-15/h2-3,6-7,9-10,12,16-17,19H,4-5,8,11H2,1H3/t16-,17-/m1/s1 [1] |
| InChIKey | DNRNSIJBSCBESJ-IAGOWNOFSA-N [1] |
Methylnaphthidate (also known as hdmp-28, DL-Threo-methylnaphthidate, Methyl 2-(naphthalen-2-yl)-2-(piperidin-2-yl)acetate, 2-Piperidineacetic acid, alpha-2-naphthalenyl-, methyl ester, 2-Piperidineacetic acid, alpha-2-naphthalenyl-, methyl ester, (alphaR,2R)-rel-, 2-PIPERIDINEACETIC ACID, .ALPHA.-2-NAPHTHALENYL-, METHYL ESTER, 2-PIPERIDINEACETIC ACID, .ALPHA.-2-NAPHTHALENYL-, METHYL ESTER, (.ALPHA.R,2R)-REL- or (R)-methyl 2-(naphthalen-2-yl)-2-((R)-piperidin-2-yl)acetate) is a
Chemistry
Salts []
Methylnaphthidate is typically found in the form of its hydrochloride salt.
Stereochemistry []
Methylnaphthidate is a racemic mixture of the optical stereoisomers