Methoxamine
| Methoxamine | |
|---|---|
| Esters [] | |
|---|---|
| Methoxamine acetate | |
| Molecular structure via molpic based on CDK |
| Physical properties [] | |
|---|---|
| Molecular mass | 211.26 g/mol [1] |
| Predicted LogP | 0.5 [1] |
| Structural Identifiers [] | |
|---|---|
| Molecular formula | C11H17NO3 [1] |
| IUPAC name | (1S,2R)-2-amino-1-(2,5-dimethoxyphenyl)propan-1-ol [1] |
| SMILES | C[C@H]([C@H](C1=C(C=CC(=C1)OC)OC)O)N [1] |
| InChI | InChI=1S/C11H17NO3/c1-7(12)11(13)9-6-8(14-2)4-5-10(9)15-3/h4-7,11,13H,12H2,1-3H3/t7-,11-/m1/s1 [1] |
| InChIKey | WJAJPNHVVFWKKL-RDDDGLTNSA-N [1] |
| Pharmacokinetics[] | |
|---|---|
| Elimination half-life | 3 hours |
Methoxamine (also known as (+-)-Methoxamine, (+)-Methoxamine, Methoxamine, (+)-, (A+/-)-Methoxamine, 1R,2s-methoxamine, 1R, 2s methoxamine, Methoxamine, 1r,2s-, Norephedrine, 2,5-dimethoxy-, Benzenemethanol, α-[(1R)-1-aminoethyl]-2,5-dimethoxy-, (αS)- or 13641-73-1) is a sympathomimetic substance of the phenylethanolamine class.
Chemistry
Esters []
Methoxamine is typically found in the form of its acetate ester.
Stereochemistry []
Methoxamine is a absolute mixture.