| Met | |
|---|---|
| Esters [] | |
|---|---|
| Methionine acetate | |
| Molecular structure via molpic based on CDK |
| Rotamer [] | |
|---|---|
| Conformer structure via 3Dmol.js |
| Physical properties [] | |
|---|---|
| Molecular mass | 149.21 g/mol [1] |
| Density | Relative density (water = 1): 1.3 g/cm3 [1] |
| Melting point | 281 °C [1] |
| Boiling point | 300.00 to 301.00 °C. @ 760.00 mm Hg [1] |
| Decomposition | 281 °C [1] |
| Solubility | 32.7 mg/mL at 25 °C [1] |
| Predicted LogP | -1.9 [1] |
| Structural Identifiers [] | |
|---|---|
| Molecular formula | C5H11NO2S [1] |
| IUPAC name | 2-amino-4-methylsulfanylbutanoic acid [1] |
| SMILES | CSCCC(C(=O)O)N [1] |
| InChI | InChI=1S/C5H11NO2S/c1-9-3-2-4(6)5(7)8/h4H,2-3,6H2,1H3,(H,7,8) [1] |
| InChIKey | FFEARJCKVFRZRR-UHFFFAOYSA-N [1] |
Methionine
Methionine (also known as Racemethionine, Acimetion, Lobamine, Urimeth, DL-Methioninum, FEMA No. 3301, CCRIS 3717, AI3-18475, Padameth or Methio-Form) is a
Chemistry
Salts and Esters []
Methionine is typically found in the form of its hydrochloride salt
or its acetate ester.
Stereochemistry []
DL-Methionine is a racemic mixture of the logical stereoisomers
Anodyne