Anodyne| Validolum | |
|---|---|
| Molecular structure via molpic |
| Physical properties [] | |
|---|---|
| Molecular mass | 240.38 g/mol [1] |
| Density | 0.900-0.910 g/cm3 [1] |
| Predicted LogP | 4.9 [1] |
| Boiling point | 260.00 to 262.00 °C. @ 750.00 mm Hg [1] |
| Solubility | insoluble in water [1] |
| Structural Identifiers [] | |
|---|---|
| Molecular formula | C15H28O2 [1] |
| IUPAC name | [(1R,2S,5R)-5-methyl-2-propan-2-ylcyclohexyl] 3-methylbutanoate [1] |
| SMILES | C[C@@H]1CC[C@H]([C@@H](C1)OC(=O)CC(C)C)C(C)C [1] |
| InChI | InChI=1S/C15H28O2/c1-10(2)8-15(16)17-14-9-12(5)6-7-13(14)11(3)4/h10-14H,6-9H2,1-5H3/t12-,13+,14-/m1/s1 [1] |
| InChIKey | VYQSSWZYPCCBRN-HZSPNIEDSA-N [1] |
| Dosing |
|---|
Menthyl isovalerate
(Redirected from menthyl isovalerate)
Menthyl isovalerate (also known as Menthyl isovalerate, 89-47-4, P5M0O284O6, Butanoic acid, 3-methyl-, (1R,2S,5R)-5-methyl-2-(1-methylethyl)cyclohexyl ester, Butanoic acid, 3-methyl-, (1R,2S,5R)-5-methyl-2-(1-methylethyl)cyclohexyl ester, rel-, Menthyl valerate, Fema no. 4156, (1R,2S,5R)-5-methyl-2-(propan-2-yl)cyclohexyl 3-methylbutanoate, Butanoic acid, 3-methyl-, 5-methyl-2-(1-methylethyl)cyclohexyl ester, (1α,2β,5α)- or Butanoic acid, 3-methyl-, 5-methyl-2-(1-methylethyl)cyclohexyl ester, (1r-(1α,2β,5α))-) is a substance of the carboxylic acid class.