Isopropylphenidine
| NPDPA | |
|---|---|
| Molecular structure via molpic based on CDK |
| Physical properties [] | |
|---|---|
| Molecular mass | 239.35 g/mol [1] |
| Predicted LogP | 4.1 [1] |
| Structural Identifiers [] | |
|---|---|
| Molecular formula | C17H21N [1] |
| IUPAC name | N-(1,2-diphenylethyl)propan-2-amine [1] |
| SMILES | CC(C)NC(CC1=CC=CC=C1)C2=CC=CC=C2 [1] |
| InChI | InChI=1S/C17H21N/c1-14(2)18-17(16-11-7-4-8-12-16)13-15-9-5-3-6-10-15/h3-12,14,17-18H,13H2,1-2H3 [1] |
| InChIKey | FBRJTEBLJRHAQX-UHFFFAOYSA-N [1] |
Isopropylphenidine (also known as Isophenidine, n-(1,2-diphenylethyl)propan-2-amine, (1,2-Diphenylethyl)(propan-2-yl)amine, N-(1-Methylethyl)-α-phenylbenzeneethanamine, Benzeneethanamine, N-(1-methylethyl)-α-phenyl-, N-(1-methylethyl)-α-phenylbenzeneethanamine, Benzeneethanamine, n-(1-methylethyl)-α-phenyl- or N-i-propyl-1,2-diphenylethylamine) is a
Chemistry
Salts []
Isopropylphenidine is typically found in the form of its hydrochloride salt.
Stereochemistry []
(RS)-Isopropylphenidine is a racemic mixture of the optical stereoisomers
Subjective effects []
Legal status []
- Germany: Isopropylphenidine is a Neuer-Psychoaktiver-Stoff under the "Neue-psychoaktive-Stoffe-Gesetz (NpSG)".
- United Kingdom: Isopropylphenidine is a PSA substance.