| Isoprenaline | |
|---|---|
| Molecular structure via molpic based on CDK |
| Rotamer [] | |
|---|---|
| Conformer structure via 3Dmol.js |
| Physical properties [] | |
|---|---|
| Molecular mass | 211.26 g/mol [1] |
| Melting point | 170.5 °C [1] |
| Solubility | 5.86e+00 g/L [1] |
| Predicted LogP | -0.6 [1] |
| Structural Identifiers [] | |
|---|---|
| Molecular formula | C11H17NO3 [1] |
| IUPAC name | 4-[1-hydroxy-2-(propan-2-ylamino)ethyl]benzene-1,2-diol [1] |
| SMILES | CC(C)NCC(C1=CC(=C(C=C1)O)O)O [1] |
| InChI | InChI=1S/C11H17NO3/c1-7(2)12-6-11(15)8-3-4-9(13)10(14)5-8/h3-5,7,11-15H,6H2,1-2H3 [1] |
| InChIKey | JWZZKOKVBUJMES-UHFFFAOYSA-N [1] |
| Pharmacokinetics[] | |
|---|---|
| Elimination half-life | Intravenous infusion: 2.5–5 min Oral: 40 min |
| Duration of action | Inhalation: 0.5–2 hours |
Isoprenaline
Isoprenaline (also known as isoproterenol, Isopropydrin, Asiprenol, Assiprenol, Bellasthman, Isoprenalin, Respifral, Aludrine, Asmalar or Neodrenal) is a sympathomimetic substance of the phenylethanolamine and catecholamine class.
Chemistry
Salts []
Isoprenaline is typically found in the form of its hydrochloride and sulfate salts.
Stereochemistry []
(RS)-Isoprenaline is a racemic mixture of the optical stereoisomers
Legal status []
- Australia: Isoprenaline is a S4 substance.