Harmine
| Harmine | |
|---|---|
| Molecular structure via molpic based on CDK |
| Physical properties [] | |
|---|---|
| Molecular mass | 212.25 g/mol [1] |
| Melting point | 264 - 265 °C [1] |
| Predicted LogP | 3.6 [1] |
| Structural Identifiers [] | |
|---|---|
| Molecular formula | C13H12N2O [1] |
| IUPAC name | 7-methoxy-1-methyl-9H-pyrido[3,4-b]indole [1] |
| SMILES | CC1=NC=CC2=C1NC3=C2C=CC(=C3)OC [1] |
| InChI | InChI=1S/C13H12N2O/c1-8-13-11(5-6-14-8)10-4-3-9(16-2)7-12(10)15-13/h3-7,15H,1-2H3 [1] |
| InChIKey | BXNJHAXVSOCGBA-UHFFFAOYSA-N [1] |
Harmine (also known as 7-Methoxy-1-methyl-9H-pyrido[3,4-b]indole, Banisterine, Telepathine, Leucoharmine, Yageine, Yajeine, 9H-Pyrido[3,4-b]indole, 7-methoxy-1-methyl-, 7-Methoxy-1-methyl-9H-β-carboline, Banisterin or Telepathin) is a monoamine oxidase inhibitor substance of the β-carboline class.
Chemistry
Salts []
Harmine is typically found in the form of its hydrochloride salt.
Stereochemistry []
Harmine is a achiral mixture.