Harmane
| Harmane | |
|---|---|
| Molecular structure via molpic based on CDK |
| Rotamer [] | |
|---|---|
| Conformer structure via 3Dmol.js |
| Physical properties [] | |
|---|---|
| Molecular mass | 182.22 g/mol [1] |
| Melting point | 237 - 238 °C [1] |
| Predicted LogP | 3.6 [1] |
| Structural Identifiers [] | |
|---|---|
| Molecular formula | C12H10N2 [1] |
| IUPAC name | 1-methyl-9H-pyrido[3,4-b]indole [1] |
| SMILES | CC1=NC=CC2=C1NC3=CC=CC=C23 [1] |
| InChI | InChI=1S/C12H10N2/c1-8-12-10(6-7-13-8)9-4-2-3-5-11(9)14-12/h2-7,14H,1H3 [1] |
| InChIKey | PSFDQSOCUJVVGF-UHFFFAOYSA-N [1] |
Harmane (also known as Harman, 1-Methyl-9H-pyrido[3,4-b]indole, Aribine, Locuturine, Loturine, Aribin, Passiflorin, 1-Methylnorharman, Locuturin or 3-Methyl-4-carboline) is a neurotoxin substance of the β-carboline class.
Chemistry
Salts []
Harmane is typically found in the form of its hydrochloride salt.
Stereochemistry []
Harmane is a achiral mixture