Eutylone
| Eutylone | |
|---|---|
| Molecular structure via molpic based on CDK |
| Rotamer [] | |
|---|---|
| Conformer structure via 3Dmol.js |
| Physical properties [] | |
|---|---|
| Molecular mass | 235.28 g/mol [1] |
| Predicted LogP | 2.3 [1] |
| Structural Identifiers [] | |
|---|---|
| Molecular formula | C13H17NO3 [1] |
| IUPAC name | 1-(1,3-benzodioxol-5-yl)-2-(ethylamino)butan-1-one [1] |
| SMILES | CCC(C(=O)C1=CC2=C(C=C1)OCO2)NCC [1] |
| InChI | InChI=1S/C13H17NO3/c1-3-10(14-4-2)13(15)9-5-6-11-12(7-9)17-8-16-11/h5-7,10,14H,3-4,8H2,1-2H3 [1] |
| InChIKey | YERSNXHEOIYEGX-UHFFFAOYSA-N [1] |
Eutylone (also known as BK-EBDB, Butyrophenone, 2-(ethylamino)-3',4'-(methylenedioxy), 1-Butanone, 1-(1,3-benzodioxol-5-yl)-2-(ethylamino)-, BETA-KETO-ETHYLBENZODIOXOLYLBUTANAMINE, EUTYLONE (NFLIS-DRUG), 1-(2H-1,3-Benzodioxol-5-yl)-2-(ethylamino)butan-1-one, DL-eutylone, DEA NO. 7549, CHB85566 or C22708) is a
Chemistry
Salts []
Eutylone is typically found in the form of its hydrochloride salt.
Stereochemistry []
Eutylone is a racemic mixture of the optical stereoisomers