Ethinylestradiol
| EE | |
|---|---|
| Molecular structure via molpic based on CDK |
| Physical properties [] | |
|---|---|
| Molecular mass | 296.4 g/mol [1] |
| Appearance | Fine, white to creamy white crystalline powder [1] |
| Odor | Odorless [1] |
| Melting point | 288 to 295 °F (NTP, 1992) [1] |
| Decomposition | When heated to decomposition it emits acrid smoke and irritating fumes. [1] |
| Solubility | less than 1 mg/mL at 70 °F (NTP, 1992) [1] |
| Predicted LogP | 3.7 [1] |
| Structural Identifiers [] | |
|---|---|
| Molecular formula | C20H24O2 [1] |
| IUPAC name | (8R,9S,13S,14S,17R)-17-ethynyl-13-methyl-7,8,9,11,12,14,15,16-octahydro-6H-cyclopenta[a]phenanthrene-3,17-diol [1] |
| SMILES | C[C@]12CC[C@H]3[C@H]([C@@H]1CC[C@]2(C#C)O)CCC4=C3C=CC(=C4)O [1] |
| InChI | InChI=1S/C20H24O2/c1-3-20(22)11-9-18-17-6-4-13-12-14(21)5-7-15(13)16(17)8-10-19(18,20)2/h1,5,7,12,16-18,21-22H,4,6,8-11H2,2H3/t16-,17-,18+,19+,20+/m1/s1 [1] |
| InChIKey | BFPYWIDHMRZLRN-SLHNCBLASA-N [1] |
| Pharmacokinetics[] | |
|---|---|
| Elimination half-life | 7–36 hours |
Ethinylestradiol (also known as ethinyl estradiol, Ethynylestradiol, Ethynyl estradiol, Ethinyloestradiol, Ginestrene, 17α-Ethynylestradiol, Amenoron, Dyloform, Estorals or Ethinoral) is a
Chemistry
Stereochemistry []
Ethinylestradiol is a absolute mixture