Anodyne| E3 | |
|---|---|
 |
| Esters [] | |
|---|---|
| Estriol propionate | |
| |
| Estriol dipropionate | |
|
| Molecular structure via molpic | |
| Conformer structure via 3Dmol.js | |
| Molecular formula | C18H24O3[1] |
|---|---|
| Molecular mass | 288.4 g/mol[1] |
| Density | 1.27 g/cu cm at 25 °C g/cm3[1] |
| Appearance | Leaflets from alcohol[1] |
| Odor | Odorless[1] |
| Predicted LogP | 2.5[1] |
| Melting point | 82-86[1] |
| Decomposition | When heated to decomposition it emits acrid smoke and irritating fumes.[1] |
| Solubility | Slightly soluble in ethyl ether, benzene, trifluoroacetic acid; very soluble in pyridine[1] |
| Chirality | absolute[2] |
| Identifiers [] | |
|---|---|
| IUPAC name | (8R,9S,13S,14S,16R,17R)-13-methyl-6,7,8,9,11,12,14,15,16,17-decahydrocyclopenta[a]phenanthrene-3,16,17-triol[1] |
| SMILES | C[C@]12CC[C@H]3[C@H]([C@@H]1C[C@H]([C@@H]2O)O)CCC4=C3C=CC(=C4)O[1] |
| InChI | InChI=1S/C18H24O3/c1-18-7-6-13-12-5-3-11(19)8-10(12)2-4-14(13)15(18)9-16(20)17(18)21/h3,5,8,13-17,19-21H,2,4,6-7,9H2,1H3/t13-,14-,15+,16-,17+,18+/m1/s1[1] |
| InChIKey | PROQIPRRNZUXQM-ZXXIGWHRSA-N[1] |
| Dosing |
|---|
Estriol
Estriol (also known as Trihydroxyestrin, Aacifemine, Estratriol, Ovestrion, Destriol, Theelol, Tridestrin, Oestratriol, Orestin or Ortho-Gynest) is a substance of the steroid class.
Chemistry
Estriol is typically found in the form of its propionate and dipropionate esters.
Stereochemistry
Estriol is a absolute mixture