| E3 | |
|---|---|
| Esters [] | |
|---|---|
| Estriol propionate | |
| Estriol dipropionate | |
| Molecular structure via molpic based on CDK |
| Rotamer [] | |
|---|---|
| Conformer structure via JSmol |
| Physical properties [] | |
|---|---|
| Molecular mass | 288.4 g/mol [1] |
| Density | 1.27 g/cu cm at 25 °C g/cm3 [1] |
| Appearance | Leaflets from alcohol [1] |
| Odor | Odorless [1] |
| Melting point | 82-86 [1] |
| Decomposition | When heated to decomposition it emits acrid smoke and irritating fumes. [1] |
| Solubility | Slightly soluble in ethyl ether, benzene, trifluoroacetic acid; very soluble in pyridine [1] |
| Predicted LogP | 2.5 [1] |
| Structural Identifiers [] | |
|---|---|
| Molecular formula | C18H24O3 [1] |
| IUPAC name | (8R,9S,13S,14S,16R,17R)-13-methyl-6,7,8,9,11,12,14,15,16,17-decahydrocyclopenta[a]phenanthrene-3,16,17-triol [1] |
| SMILES | C[C@]12CC[C@H]3[C@H]([C@@H]1C[C@H]([C@@H]2O)O)CCC4=C3C=CC(=C4)O [1] |
| InChI | InChI=1S/C18H24O3/c1-18-7-6-13-12-5-3-11(19)8-10(12)2-4-14(13)15(18)9-16(20)17(18)21/h3,5,8,13-17,19-21H,2,4,6-7,9H2,1H3/t13-,14-,15+,16-,17+,18+/m1/s1 [1] |
| InChIKey | PROQIPRRNZUXQM-ZXXIGWHRSA-N [1] |
Estriol
Estriol (also known as Trihydroxyestrin, Aacifemine, Estratriol, Ovestrion, Destriol, Theelol, Tridestrin, Oestratriol, Orestin or Ortho-Gynest) is a
Chemistry
Esters []
Estriol is typically found in the form of its propionate and dipropionate esters.
Stereochemistry []
Estriol is a absolute mixture