| THC | |||
|---|---|---|---|
| Molecular structure via molpic based on CDK |
| Physical properties [] | |
|---|---|
| Molecular mass | 314.5 g/mol [1] |
| Appearance | Light yellow resinous oil [1] |
| Melting point | 200 °C [1] |
| Boiling point | 392 ° [1] |
| Decomposition | When heated to decomposition it emits acrid smoke and irritating fumes. [1] |
| Solubility | 2.8 mg/L at 73 °F (NTP, 1992) [1] |
| Predicted LogP | 7 [1] |
| Structural Identifiers [] | |
|---|---|
| Molecular formula | C21H30O2 [1] |
| IUPAC name | (6aR,10aR)-6,6,9-trimethyl-3-pentyl-6a,7,8,10a-tetrahydrobenzo[c]chromen-1-ol [1] |
| SMILES | CCCCCC1=CC(=C2C3C=C(CCC3C(OC2=C1)(C)C)C)O [1] |
| InChI | InChI=1S/C21H30O2/c1-5-6-7-8-15-12-18(22)20-16-11-14(2)9-10-17(16)21(3,4)23-19(20)13-15/h11-13,16-17,22H,5-10H2,1-4H3/t16-,17-/m1/s1 [1] |
| InChIKey | CYQFCXCEBYINGO-IAGOWNOFSA-N [1] |
Tetrahydrocannabinol
(Redirected from delta-9-tetrahydrocannabinol)Tetrahydrocannabinol (also known as Dronabinol, Marinol, delta9-Tetrahydrocannabinol, delta9-THC, delta-9-tetrahydrocannabinol, Deltanyne, Abbott 40566, delta-9-THC, delta(9)-THC or Dronabinolum)
Chemistry
Salts []
Tetrahydrocannabinol is typically found in the form of its succinate salt.
Stereochemistry []
Tetrahydrocannabinol is a absolute mixture
| Anodyne Usernotes [] | |||
|---|---|---|---|
| magnus / Tetrahydrocannabinol via Vaporized |
0xea / Tetrahydrocannabinol via Vaporized | | |