Cortisone
| Cortisone | |
|---|---|
| Esters [] | |
|---|---|
| Cortisone acetate | |
| Molecular structure via molpic based on CDK |
| Physical properties [] | |
|---|---|
| Molecular mass | 360.4 g/mol [1] |
| Melting point | 222 °C [1] |
| Solubility | 0.28 mg/mL at 25 °C [1] |
| Predicted LogP | 1.5 [1] |
| Structural Identifiers [] | |
|---|---|
| Molecular formula | C21H28O5 [1] |
| IUPAC name | (8S,9S,10R,13S,14S,17R)-17-hydroxy-17-(2-hydroxyacetyl)-10,13-dimethyl-1,2,6,7,8,9,12,14,15,16-decahydrocyclopenta[a]phenanthrene-3,11-dione [1] |
| SMILES | C[C@]12CCC(=O)C=C1CC[C@@H]3[C@@H]2C(=O)C[C@]4([C@H]3CC[C@@]4(C(=O)CO)O)C [1] |
| InChI | InChI=1S/C21H28O5/c1-19-7-5-13(23)9-12(19)3-4-14-15-6-8-21(26,17(25)11-22)20(15,2)10-16(24)18(14)19/h9,14-15,18,22,26H,3-8,10-11H2,1-2H3/t14-,15-,18+,19-,20-,21-/m0/s1 [1] |
| InChIKey | MFYSYFVPBJMHGN-ZPOLXVRWSA-N [1] |
Cortisone (also known as Kendall's compound E, Cortisate, Cortistal, Cortivite, Andreson, Cortisal, Reichstein's substance FA, Adrenalex, Cortogen or Reichstein Fa) is a
Chemistry
Esters []
Cortisone is typically found in the form of its acetate ester.
Stereochemistry []
Cortisone is a absolute mixture