Cortisone | |
---|---|
Esters [] | |
---|---|
Cortisone acetate | |
Molecular structure via molpic | |
Conformer structure via 3Dmol.js | |
Molecular formula | C21H28O5 |
---|---|
Molecular mass | 360.4 g/mol |
Predicted LogP | 1.5 |
Melting point | 222 °C |
Solubility | 0.28 mg/mL at 25 °C |
Chirality | absolute |
Identifiers [] | |
---|---|
IUPAC name | (8S,9S,10R,13S,14S,17R)-17-hydroxy-17-(2-hydroxyacetyl)-10,13-dimethyl-1,2,6,7,8,9,12,14,15,16-decahydrocyclopenta[a]phenanthrene-3,11-dione |
SMILES | C[C@]12CCC(=O)C=C1CC[C@@H]3[C@@H]2C(=O)C[C@]4([C@H]3CC[C@@]4(C(=O)CO)O)C |
InChI | InChI=1S/C21H28O5/c1-19-7-5-13(23)9-12(19)3-4-14-15-6-8-21(26,17(25)11-22)20(15,2)10-16(24)18(14)19/h9,14-15,18,22,26H,3-8,10-11H2,1-2H3/t14-,15-,18+,19-,20-,21-/m0/s1 |
InChIKey | MFYSYFVPBJMHGN-ZPOLXVRWSA-N |
Dosing |
---|
Cortisone
Cortisone (also known as Kendall's compound E, Cortisate, Cortistal, Cortivite, Andreson, Cortisal, Reichstein's substance FA, Adrenalex, Cortogen or Reichstein Fa) is a hormone substance of the steroid class.
Chemistry
Cortisone is typically found in the form of its acetate ester.