Corbadrine
| Corbadrine | |
|---|---|
| Molecular structure via molpic based on CDK |
| Rotamer [] | |
|---|---|
| Conformer structure via 3Dmol.js |
| Physical properties [] | |
|---|---|
| Molecular mass | 183.20 g/mol [1] |
| Predicted LogP | -0.8 [1] |
| Structural Identifiers [] | |
|---|---|
| Molecular formula | C9H13NO3 [1] |
| IUPAC name | 4-(2-amino-1-hydroxypropyl)benzene-1,2-diol [1] |
| SMILES | CC(C(C1=CC(=C(C=C1)O)O)O)N [1] |
| InChI | InChI=1S/C9H13NO3/c1-5(10)9(13)6-2-3-7(11)8(12)4-6/h2-5,9,11-13H,10H2,1H3 [1] |
| InChIKey | GEFQWZLICWMTKF-UHFFFAOYSA-N [1] |
Corbadrine (also known as Nordefrin, Methylnoradrenaline, Isoadrenaline, Nordephrine, Dioxynorepinephrine, Dihydroxyphenylpropanolamine, 2-Amino-1-(3,4-dihydroxyphenyl)propan-1-ol, l-α-Methylnorepinephrine, (+-)-3,4-Dihydroxynorephedrine or α-Methylnorepinephrine) is a sympathomimetic substance of the phenylethanolamine and catecholamine class.
Stereochemistry []
Corbadrine is a