Anodyne| Brotizolam | |
|---|---|
 | |
| Molecular structure via molpic | |
| Conformer structure via 3Dmol.js | |
| Molecular formula | C15H10BrClN4S[1] |
| Molecular mass | 393.7 g/mol[1] |
| Predicted LogP | 2.8[1] |
| Melting point | 211-213[1] |
| Chirality | achiral[2] |
| Identifiers [] | |
|---|---|
| IUPAC name | 4-bromo-7-(2-chlorophenyl)-13-methyl-3-thia-1,8,11,12-tetrazatricyclo[8.3.0.02,6]trideca-2(6),4,7,10,12-pentaene[1] |
| SMILES | CC1=NN=C2N1C3=C(C=C(S3)Br)C(=NC2)C4=CC=CC=C4Cl[1] |
| InChI | InChI=1S/C15H10BrClN4S/c1-8-19-20-13-7-18-14(9-4-2-3-5-11(9)17)10-6-12(16)22-15(10)21(8)13/h2-6H,7H2,1H3[1] |
| InChIKey | UMSGKTJDUHERQW-UHFFFAOYSA-N[1] |
| Dosing | |
|---|---|
| Elimination half-life | 4.4 hours (range, 2.6–6.9 h) |
Brotizolam
Brotizolam (also known as Lendormin, Lendorm, Mederantil, Sintonal, WE 941, Brotizolamum, Nimbisan, WE-941, 2-bromo-4-(2-chlorophenyl)-9-methyl-6H-thieno[3,2-f][1,2,4]triazolo[4,3-a][1,4]diazepine or WE-941-BS) is a substance of the thienodiazepine class.
Chemistry
Stereochemistry
Brotizolam is a achiral mixture
Legal status
- Brazil: Brotizolam is a B1 substance.
- Canada: Brotizolam is a Schedule IV substance.
- United States: Brotizolam is a Unscheduled substance.
- United Kingdom: Brotizolam is a Class C substance.
- Germany: Brotizolam is a prescription only/Anlage III substance.
- United Nations: Brotizolam is a Schedule IV substance.