Anodyne| BADGE | |
|---|---|
 | |
| Molecular structure via molpic |
| Physical properties [] | |
|---|---|
| Molecular mass | 340.4 g/mol [1] |
| Density | 1.16 at 68 °F (USCG, 1999) - Denser than water; will sink g/cm3 [1] |
| Appearance | Sticky [1] |
| Odor | Odorless [1] |
| Predicted LogP | 4 [1] |
| Melting point | 46 to 54 °F (NTP, 1992) [1] |
| Boiling point | Decomposes (NTP, 1992) [1] |
| Decomposition | When heated to decomposition it emits acrid smoke and irritating fumes. [1] |
| Solubility | less than 1 mg/mL at 67.1 °F (NTP, 1992) [1] |
| Structural Identifiers [] | |
|---|---|
| Molecular formula | C21H24O4 [1] |
| IUPAC name | 2-[[4-[2-[4-(oxiran-2-ylmethoxy)phenyl]propan-2-yl]phenoxy]methyl]oxirane [1] |
| SMILES | CC(C)(C1=CC=C(C=C1)OCC2CO2)C3=CC=C(C=C3)OCC4CO4 [1] |
| InChI | InChI=1S/C21H24O4/c1-21(2,15-3-7-17(8-4-15)22-11-19-13-24-19)16-5-9-18(10-6-16)23-12-20-14-25-20/h3-10,19-20H,11-14H2,1-2H3 [1] |
| InChIKey | LCFVJGUPQDGYKZ-UHFFFAOYSA-N [1] |
| Dosing |
|---|
Bisphenol A diglycidyl ether
(Redirected from bisphenol a diglycidyl ether)
Bisphenol A diglycidyl ether (also known as Bisphenol a diglycidyl ether, 2,2-Bis(4-glycidyloxyphenyl)propane, Epoxide A, Epophen EL 5, Diglycidyl bisphenol A ether, DGEBPA, Dian diglycidyl ether, Diglycidyl bisphenol A, epi-Rez 510 or 2,2-Bis(4'-glycidyloxyphenyl)propane) is a substance of the phenol class.