Bisphenol A
| BPA | |
|---|---|
| Molecular structure via molpic based on CDK |
| Physical properties [] | |
|---|---|
| Molecular mass | 228.29 g/mol [1] |
| Density | 1.195 at 77 °F (USCG, 1999) - Denser than water; will sink g/cm3 [1] |
| Appearance | Crystallizes as prisms from dil acetic acid and as needles from water [1] |
| Odor | Mild phenolic odor [1] |
| Melting point | 307 to 313 °F (NTP, 1992) [1] |
| Boiling point | 428 ° [1] |
| Decomposition | Hazardous decomposition products formed under fire conditions - Carbon oxides. [1] |
| Solubility | less than 1 mg/mL at 70.7 °F (NTP, 1992) [1] |
| Predicted LogP | 3.3 [1] |
| Structural Identifiers [] | |
|---|---|
| Molecular formula | C15H16O2 [1] |
| IUPAC name | 4-[2-(4-hydroxyphenyl)propan-2-yl]phenol [1] |
| SMILES | CC(C)(C1=CC=C(C=C1)O)C2=CC=C(C=C2)O [1] |
| InChI | InChI=1S/C15H16O2/c1-15(2,11-3-7-13(16)8-4-11)12-5-9-14(17)10-6-12/h3-10,16-17H,1-2H3 [1] |
| InChIKey | IISBACLAFKSPIT-UHFFFAOYSA-N [1] |
(Redirected from bisphenol-a)
Bisphenol A (also known as 4,4'-Isopropylidenediphenol, 2,2-Bis(p-hydroxyphenyl)propane, Diphenylolpropane, 4,4'-Bisphenol A, Diano, Bisphenol-A, Biphenol A, Parabis A, 4,4'-(propane-2,2-diyl)diphenol or DIAN) is a
Chemistry
Stereochemistry []
Bisphenol A is a achiral mixture.