Benzocaine
| Benzocaine | |
|---|---|
| Molecular structure via molpic based on CDK |
| Physical properties [] | |
|---|---|
| Molecular mass | 165.19 g/mol [1] |
| Appearance | Rhombohedra from ether [1] |
| Melting point | 92 °C [1] |
| Boiling point | 310 °C [1] |
| Solubility | >24.8 [ug/mL] (The mean of the results at pH 7.4) [1] |
| Predicted LogP | 1.9 [1] |
| Structural Identifiers [] | |
|---|---|
| Molecular formula | C9H11NO2 [1] |
| IUPAC name | ethyl 4-aminobenzoate [1] |
| SMILES | CCOC(=O)C1=CC=C(C=C1)N [1] |
| InChI | InChI=1S/C9H11NO2/c1-2-12-9(11)7-3-5-8(10)6-4-7/h3-6H,2,10H2,1H3 [1] |
| InChIKey | BLFLLBZGZJTVJG-UHFFFAOYSA-N [1] |
| Dosing[] |
|---|
| Sublingual [] | |
|---|---|
| Threshold | 20 |
| Light | ≤ 20 |
| Common | 20 |
| Strong | 20 |
| Heavy | 20 |
Statistically derived dosages via DBI-IGS We do not take any responsibility for medical complications or loss of life sustained by following these dosages blindly. |
Benzocaine (also known as Ethyl 4-aminobenzoate, Ethyl p-aminobenzoate, Parathesin, Norcaine, Anesthesin, Parathesine, Amben ethyl ester, p-Carbethoxyaniline, Anaesthin or Anesthesine) is a sodium channel blocker substance of the alcohol class.
Chemistry
Salts []
Benzocaine is typically found in the form of its hydrochloride salt.
Stereochemistry []
Benzocaine is a achiral mixture.
Pharmacology
ATC Classification
Metabolism
Subjective effects []
| 0xea / Benzocaine [] | |
|---|---|
Routes:
| |
Legal status []
- United States: Benzocaine is a OTC substance.
- United Kingdom: Benzocaine is a GSL, P substance.