Androstenedione
| A4 | |
|---|---|
| Molecular structure via molpic based on CDK |
| Physical properties [] | |
|---|---|
| Molecular mass | 286.4 g/mol [1] |
| Density | 1.18 g/cu cm at 20 °C (GLP compliance study) g/cm3 [1] |
| Appearance | Crystals from hexane [1] |
| Melting point | 173-174 °C (crystals from hexane) [1] |
| Boiling point | Decomposes at 200 °C before boiling [1] |
| Decomposition | When heated to decomposition it emits acrid smoke and irritating fumes. [1] |
| Solubility | In water, 57.3 mg/L at 25 °C, pH 7.3; 40 mg/L at 37 °C, pH 7.4 [1] |
| Predicted LogP | 2.7 [1] |
| Structural Identifiers [] | |
|---|---|
| Molecular formula | C19H26O2 [1] |
| IUPAC name | (8R,9S,10R,13S,14S)-10,13-dimethyl-2,6,7,8,9,11,12,14,15,16-decahydro-1H-cyclopenta[a]phenanthrene-3,17-dione [1] |
| SMILES | C[C@]12CCC(=O)C=C1CC[C@@H]3[C@@H]2CC[C@]4([C@H]3CCC4=O)C [1] |
| InChI | InChI=1S/C19H26O2/c1-18-9-7-13(20)11-12(18)3-4-14-15-5-6-17(21)19(15,2)10-8-16(14)18/h11,14-16H,3-10H2,1-2H3/t14-,15-,16-,18-,19-/m0/s1 [1] |
| InChIKey | AEMFNILZOJDQLW-QAGGRKNESA-N [1] |
Androstenedione (also known as Androst-4-ene-3,17-dione, 4-Androstene-3,17-dione, 4-Androstenedione, Androtex, 3,17-Dioxoandrost-4-ene, Fecundin, SKF 2170, Δ-4-Androsten-3,17-dione, 17-Ketotestosterone or Δ-(sup4)-Androsten-3,17-dione) is a
Chemistry
Stereochemistry []
Androstenedione is a absolute mixture.
Subjective effects []
Legal status []
- United States: Androstenedione is a Schedule III substance.