Anabasine
| Anabasine | |
|---|---|
| Salts [] | |
|---|---|
| %!s( | |
| Molecular structure via molpic based on CDK |
| Rotamer [] | |
|---|---|
| Conformer structure via JSmol |
| Physical properties [] | |
|---|---|
| Molecular mass | 162.23 g/mol [1] |
| Melting point | 9 °C [1] |
| Solubility | 1000 mg/mL at 25 °C [1] |
| Predicted LogP | 1 [1] |
| Structural Identifiers [] | |
|---|---|
| Molecular formula | C10H14N2 [1] |
| IUPAC name | 3-piperidin-2-ylpyridine [1] |
| SMILES | C1CCNC(C1)C2=CN=CC=C2 [1] |
| InChI | InChI=1S/C10H14N2/c1-2-7-12-10(5-1)9-4-3-6-11-8-9/h3-4,6,8,10,12H,1-2,5,7H2 [1] |
| InChIKey | MTXSIJUGVMTTMU-UHFFFAOYSA-N [1] |
Anabasine (also known as Anabasine, (+/-) Anabasine, (R,s)-anabasine, 2-Pyridin-3-ylpiperidine, 3-(2-piperidyl)pyridine, Pyridine, 3-(2-piperidinyl)-, (+/-)Anabasine, 40774-73-0, 2-(3-Pyridyl)piperidine or 2-(3-Pyridinyl)piperidine) is a
Chemistry
Salts []
Anabasine is typically found in the form of its hydrochloride salt.
Stereochemistry []
Anabasine is a racemic mixture of the enantiomers
| Stereoisomers |
|---|
Subjective effects []
See also []
External links []
References []
National Center for Biotechnology Information. PubChem Compound Summary for CID 2181, Anabasine. Accessed July 19, 2025. https://pubchem.ncbi.nlm.nih.gov/compound/2181