Anodyne| Venlafaxine | |
|---|---|
 | |
| Molecular structure via molpic based on CDK |
| Physical properties [] | |
|---|---|
| Molecular mass | 277.4 g/mol [1] |
| Melting point | Crystals from ethyl acetate; melting point 102-104 °C; specific optical rotation: +27.6 deg (c = 1.07 in 95% ethanol) /Venlafaxine (+)form/ [1] |
| Solubility | Molecular weight: 313.86. White to off-white crystalline solid from methanol/ethyl acetate, mp 215-217 °C. SOlubility (mg/mL): 572 water. Partition coefficient (octanol/water): 0.43 /Venlafaxine hydrochloride/ [1] |
| Predicted LogP | 2.9 [1] |
| Structural Identifiers [] | |
|---|---|
| Molecular formula | C17H27NO2 [1] |
| IUPAC name | 1-[2-(dimethylamino)-1-(4-methoxyphenyl)ethyl]cyclohexan-1-ol [1] |
| SMILES | CN(C)CC(C1=CC=C(C=C1)OC)C2(CCCCC2)O [1] |
| InChI | InChI=1S/C17H27NO2/c1-18(2)13-16(17(19)11-5-4-6-12-17)14-7-9-15(20-3)10-8-14/h7-10,16,19H,4-6,11-13H2,1-3H3 [1] |
| InChIKey | PNVNVHUZROJLTJ-UHFFFAOYSA-N [1] |
| Dosing[] |
|---|
| Oral [] | |
|---|---|
| Threshold | 20 - 37.5 |
| Light | 37.5 - 56.25 |
| Common | 56.25 - 75 |
| Strong | 75 - 131.25 |
| Heavy | 131.25 - 150 |
Statistically derived dosages via DBI-IGS We do not take any responsibility for medical complications or loss of life sustained by following these dosages blindly. |
Venlafaxine
Venlafaxine (also known as D,L-Venlafaxine, Venlafaxina, Elafax, Venlafaxinum, Efectin, velafax, 1-(2-(dimethylamino)-1-(4-methoxyphenyl)ethyl)cyclohexanol, Venlafexine, Kanghong or Trevilor) is a
Chemistry
Salts []
Venlafaxine is typically found in the form of its hydrochloride salt.
Stereochemistry []
(RS)-Venlafaxine is a racemic mixture of the optical stereoisomers