Scopolamine | |
---|---|
Esters [] | |
---|---|
Scopolamine benzoate | |
Molecular structure via molpic based on CDK |
Conformer [] | |
---|---|
Physical properties [] | |
---|---|
Molecular mass | 303.35 g/mol [1] |
Appearance | Viscous liquid [1] |
Melting point | 59 °C [1] |
Solubility | 1.0X10+5 mg/L [1] |
Predicted LogP | 0.9 [1] |
Structural Identifiers [] | |
---|---|
Molecular formula | C17H21NO4 [1] |
IUPAC name | [(1R,2R,4S,5S)-9-methyl-3-oxa-9-azatricyclo[3.3.1.02,4]nonan-7-yl] (2S)-3-hydroxy-2-phenylpropanoate [1] |
SMILES | CN1[C@@H]2CC(C[C@H]1[C@H]3[C@@H]2O3)OC(=O)[C@H](CO)C4=CC=CC=C4 [1] |
InChI | InChI=1S/C17H21NO4/c1-18-13-7-11(8-14(18)16-15(13)22-16)21-17(20)12(9-19)10-5-3-2-4-6-10/h2-6,11-16,19H,7-9H2,1H3/t11?,12-,13-,14+,15-,16+/m1/s1 [1] |
InChIKey | STECJAGHUSJQJN-USLFZFAMSA-N [1] |
Dosing [] | |
---|---|
Elimination half-life | 5 hours |
Scopolamine
Scopolamine (also known as (-)-Hyoscine, Scopine (-)-tropate, Scopine tropate, Hyosol, Scopace, Transderm-Scop, Boro-Scopol, Atrochin, Atroquin or Skopolamin) is a
Chemistry
Salts and Esters []
Scopolamine is typically found in the form of its sulfate salt
or its ester.
Stereochemistry []
Scopolamine is a absolute mixture
Legal status
- United Kingdom: Scopolamine is a prescription only substance.
- United States: Scopolamine is a prescription only substance.