Ritodrine | |
---|---|
Molecular structure via molpic based on CDK |
Physical properties [] | |
---|---|
Molecular mass | 287.35 g/mol [1] |
Melting point | 88-90 °C [1] |
Solubility | Complete [1] |
Predicted LogP | 2.3 [1] |
Structural Identifiers [] | |
---|---|
Molecular formula | C17H21NO3 [1] |
IUPAC name | 4-[2-[[(1S,2R)-1-hydroxy-1-(4-hydroxyphenyl)propan-2-yl]amino]ethyl]phenol [1] |
SMILES | C[C@H]([C@H](C1=CC=C(C=C1)O)O)NCCC2=CC=C(C=C2)O [1] |
InChI | InChI=1S/C17H21NO3/c1-12(17(21)14-4-8-16(20)9-5-14)18-11-10-13-2-6-15(19)7-3-13/h2-9,12,17-21H,10-11H2,1H3/t12-,17-/m1/s1 [1] |
InChIKey | IOVGROKTTNBUGK-SJKOYZFVSA-N [1] |
Dosing [] | |
---|---|
Elimination half-life | 1.7–2.6 hours |
Ritodrine
Ritodrine (also known as Ritodrina, DU21220, DU-21220, DU 21220, 2-(4-Hydroxyphenethylamino)-1-(4-hydroxyphenyl)propanol, p-Hydroxy-α-(1-((p-hydroxyphenethyl)amino)ethyl)benzyl alcohol, Ritodrinium, Benzyl alcohol, p-hydroxy-α-(1-((p-hydroxyphenethyl)amino)ethyl)-, erythro-, erythro-p-Hydroxy-α-(1-((p-hydroxyphenethyl)amino)ethyl)benzyl alcohol or 4-Hydroxy-α-(1-((2-(4-hydroxyphenyl)ethyl)amino)ethyl)benzenemethanol (R*,S*)-) is a tocolytic and sympathomimetic substance of the phenylethanolamine class.
Chemistry
Stereochemistry []
(RS)-Ritodrine is a racemic mixture of the optical stereoisomers