PG | |
---|---|
Esters [] | |
---|---|
Propylene glycol acetate | |
Propylene glycol dipropionate | |
Propylene glycol stearate | |
Molecular structure via molpic based on CDK |
Conformer [] | |
---|---|
Physical properties [] | |
---|---|
Molecular mass | 76.09 g/mol [1] |
Density | 1.04 at 68 °F (USCG, 1999) - Denser than water; will sink g/cm3 [1] |
Appearance | Colorless viscous liquid [1] |
Odor | Practically odorless [1] |
Taste | Practically tasteless [1] |
Melting point | -76 °F (NTP, 1992) [1] |
Boiling point | 370.8 ° [1] |
Decomposition | When heated to decomposition it emits acrid smoke and irritating fumes. [1] |
Solubility | greater than or equal to 100 mg/mL at 70 °F (NTP, 1992) [1] |
Predicted LogP | -0.9 [1] |
Structural Identifiers [] | |
---|---|
Molecular formula | C3H8O2 [1] |
IUPAC name | propane-1,2-diol [1] |
SMILES | CC(CO)O [1] |
InChI | InChI=1S/C3H8O2/c1-3(5)2-4/h3-5H,2H2,1H3 [1] |
InChIKey | DNIAPMSPPWPWGF-UHFFFAOYSA-N [1] |
Propylene glycol
(Redirected from Propylene glycol)
Propylene glycol (also known as 1,2-propanediol, 1,2-Propylene glycol, 1,2-dihydroxypropane, 2-Hydroxypropanol, Isopropylene glycol, Methylethyl glycol, Methylethylene glycol, Monopropylene glycol, Dowfrost or Sirlene) is a
Chemistry
Esters []
Propylene glycol is typically found in the form of its acetate, dipropionate and stearate esters.
Stereochemistry []
(RS)-Propylene glycol is a racemic mixture of the optical stereoisomers