Oxyfedrine | |
---|---|
Molecular structure via molpic based on CDK |
Conformer [] | |
---|---|
Conformer structure via JSmol |
Physical properties [] | |
---|---|
Molecular mass | 313.4 g/mol [1] |
Predicted LogP | 2.4 [1] |
Structural Identifiers [] | |
---|---|
Molecular formula | C19H23NO3 [1] |
IUPAC name | 3-[[(1R,2S)-1-hydroxy-1-phenylpropan-2-yl]amino]-1-(3-methoxyphenyl)propan-1-one [1] |
SMILES | C[C@@H]([C@@H](C1=CC=CC=C1)O)NCCC(=O)C2=CC(=CC=C2)OC [1] |
InChI | InChI=1S/C19H23NO3/c1-14(19(22)15-7-4-3-5-8-15)20-12-11-18(21)16-9-6-10-17(13-16)23-2/h3-10,13-14,19-20,22H,11-12H2,1-2H3/t14-,19-/m0/s1 [1] |
InChIKey | GDYUVHBMFVMBAF-LIRRHRJNSA-N [1] |
Dosing [] | |
---|---|
Elimination half-life | 4.2 hours |
Oxyfedrine
Oxyfedrine (also known as Oxifedrina, Oxifedrinum, Oxyfedrinum, (-)-oxyfedrine, 1-Propanone, 3-((2-hydroxy-1-methyl-2-phenylethyl)amino)-1-(3-methoxyphenyl)-, (R-(R*,S*))-, Oxifedrine, Oxiphedrin, Oxyphedrin, 3-(((αS,βR)-β-Hydroxy-α-methylphenethyl)amino)-3'-methoxypropiophenone or 1-Propanone, 3-(((1s,2r)-2-hydroxy-1-methyl-2-phenylethyl)amino)-1-(3-methoxyphenyl)-) is a sympathomimetic substance of the phenylethanolamine class.
Chemistry
Salts []
Oxyfedrine is typically found in the form of its hydrochloride salt.
Stereochemistry []
Oxyfedrine is a absolute mixture