Anodyne| 4-HEP | |
|---|---|
 |
| Salts [] | |
|---|---|
| Oxilofrine hydrochloride | |
|
| Molecular structure via molpic | |
| Conformer structure via 3Dmol.js | |
| Molecular formula | C10H15NO2[1] |
|---|---|
| Molecular mass | 181.23 g/mol[1] |
| Predicted LogP | 0.6[1] |
| Solubility | Partly miscible[1] |
| Chirality | racemic[2] |
| Identifiers [] | |
|---|---|
| IUPAC name | 4-[(1R,2S)-1-hydroxy-2-(methylamino)propyl]phenol[1] |
| SMILES | C[C@@H]([C@@H](C1=CC=C(C=C1)O)O)NC[1] |
| InChI | InChI=1S/C10H15NO2/c1-7(11-2)10(13)8-3-5-9(12)6-4-8/h3-7,10-13H,1-2H3/t7-,10-/m0/s1[1] |
| InChIKey | OXFGTKPPFSCSMA-XVKPBYJWSA-N[1] |
| Dosing |
|---|
Oxilofrine
Oxilofrine (also known as Methylsynephrin, Methylsympatol, Oxyephedrin, Methyl synephrin, Methyl synephrine, p-Hydroxyephedrine, Oxilofrinum, Oxyephedrine, Oxilofrina or Suprifene) is a sympathomimetic substance of the phenylethanolamine class.
Chemistry
Oxilofrine is typically found in the form of its hydrochloride salt.
Stereochemistry
(RS)-Oxilofrine is a racemic mixture of the optical stereoisomers
Legal status
- Brazil: Oxilofrine is a A3 substance.
- United States: Oxilofrine is a Unapproved "New Drug" (as defined by 21 U.S. Code ยง 321(p)(1)). Use in date=February 22, 2023 |title=Methylsynephrine in Dietary Supplements |url=https://www.fda.gov/food/dietary-supplement-ingredient-directory/methylsynephrine-dietary-supplements |access-date=June 9, 2023 |website=[[FDA}} substance.