| Naloxone | |
|---|---|
| Molecular structure via molpic based on CDK |
| Physical properties [] | |
|---|---|
| Molecular mass | 327.4 g/mol [1] |
| Appearance | Crystals from ethyl acetate [1] |
| Melting point | 178 °C [1] |
| Decomposition | When heated to decomposition it emits toxic fumes of /nitrogen oxides/. [1] |
| Solubility | Soluble [1] |
| Predicted LogP | 2.1 [1] |
| Structural Identifiers [] | |
|---|---|
| Molecular formula | C19H21NO4 [1] |
| IUPAC name | (4R,4aS,7aR,12bS)-4a,9-dihydroxy-3-prop-2-enyl-2,4,5,6,7a,13-hexahydro-1H-4,12-methanobenzofuro[3,2-e]isoquinolin-7-one [1] |
| SMILES | C=CCN1CC[C@]23[C@@H]4C(=O)CC[C@]2([C@H]1CC5=C3C(=C(C=C5)O)O4)O [1] |
| InChI | InChI=1S/C19H21NO4/c1-2-8-20-9-7-18-15-11-3-4-12(21)16(15)24-17(18)13(22)5-6-19(18,23)14(20)10-11/h2-4,14,17,21,23H,1,5-10H2/t14-,17+,18+,19-/m1/s1 [1] |
| InChIKey | UZHSEJADLWPNLE-GRGSLBFTSA-N [1] |
| Dosing[] |
|---|
| Sublingual [] | |
|---|---|
| Threshold | 0.125 - 0.25 |
| Light | 0.25 - 1 |
| Common | 1 - 1.5 |
| Strong | 1.5 - 2 |
| Heavy | 2 - 3 |
Statistically derived dosages via DBI-IGS We do not take any responsibility for medical complications or loss of life sustained by following these dosages blindly. |
Naloxone
Naloxone (also known as l-Naloxone, n-Allylnoroxymorphone, (-)-Naloxone, Narcan, Naloxona, EN 1530 base, Naloxonum, Nalossone, N-Allyl-noroxymorphone or DBL Naloxone) is a
Chemistry
Salts []
Naloxone is typically found in the form of its hydrochloride and hydrochloride dihydrate salts.
Stereochemistry []
Naloxone is a absolute mixture
Anodyne