Anodyne| MCA | |
|---|---|
 | |
| Molecular structure via molpic | |
| Conformer structure via 3Dmol.js | |
| Molecular formula | C5H5NO2[1] |
| Molecular mass | 111.10 g/mol[1] |
| Density | 1.1044 at 81 °F (NTP, 1992) - Denser than water; will sink g/cm3[1] |
| Appearance | Clear, colorless liquid[1] |
| Odor | Strong, acrid odor[1] |
| Predicted LogP | 0.6[1] |
| Melting point | -40 °C[1] |
| Boiling point | 117 to 120 °F at 1.8 mmHg (NTP, 1992)[1] |
| Decomposition | When heated to decomposition it emits toxic fumes of /nitrogen oxides and CN-/.[1] |
| Solubility | less than 1 mg/mL at 72 °F (NTP, 1992)[1] |
| Chirality | achiral[2] |
| Identifiers [] | |
|---|---|
| IUPAC name | methyl 2-cyanoprop-2-enoate[1] |
| SMILES | COC(=O)C(=C)C#N[1] |
| InChI | InChI=1S/C5H5NO2/c1-4(3-6)5(7)8-2/h1H2,2H3[1] |
| InChIKey | MWCLLHOVUTZFKS-UHFFFAOYSA-N[1] |
| Dosing |
|---|
Methylcyanoacrylate
Methylcyanoacrylate (also known as Mecrylate, Methyl 2-cyanoacrylate, 2-Propenoic acid, 2-cyano-, methyl ester, Methyl cyanoacrylate, Mecrilate, Cyanolit, Mecrilat, Adhere, Coapt or Krazy-Glue) is a substance of the cyanoacrylate class.
Chemistry
Stereochemistry
Methylcyanoacrylate is a achiral mixture