MCA | |
---|---|
Molecular structure via molpic based on CDK |
Rotamer [] | |
---|---|
Physical properties [] | |
---|---|
Molecular mass | 111.10 g/mol [1] |
Density | 1.1044 at 81 °F (NTP, 1992) - Denser than water; will sink g/cm3 [1] |
Appearance | Clear, colorless liquid [1] |
Odor | Strong, acrid odor [1] |
Melting point | -40 °C [1] |
Boiling point | 117 to 120 °F at 1.8 mmHg (NTP, 1992) [1] |
Decomposition | When heated to decomposition it emits toxic fumes of /nitrogen oxides and CN-/. [1] |
Solubility | less than 1 mg/mL at 72 °F (NTP, 1992) [1] |
Predicted LogP | 0.6 [1] |
Structural Identifiers [] | |
---|---|
Molecular formula | C5H5NO2 [1] |
IUPAC name | methyl 2-cyanoprop-2-enoate [1] |
SMILES | COC(=O)C(=C)C#N [1] |
InChI | InChI=1S/C5H5NO2/c1-4(3-6)5(7)8-2/h1H2,2H3 [1] |
InChIKey | MWCLLHOVUTZFKS-UHFFFAOYSA-N [1] |
Methylcyanoacrylate
Methylcyanoacrylate (also known as Mecrylate, Methyl 2-cyanoacrylate, 2-Propenoic acid, 2-cyano-, methyl ester, Methyl cyanoacrylate, Mecrilate, Cyanolit, Mecrilat, Adhere, Coapt or Krazy-Glue) is a
Chemistry
Stereochemistry []
Methylcyanoacrylate is a achiral mixture