Isoetarine | |
---|---|
Molecular structure via molpic based on CDK |
Conformer [] | |
---|---|
Conformer structure via JSmol |
Physical properties [] | |
---|---|
Molecular mass | 239.31 g/mol [1] |
Solubility | Appreciable [1] |
Predicted LogP | 1.7 [1] |
Structural Identifiers [] | |
---|---|
Molecular formula | C13H21NO3 [1] |
IUPAC name | 4-[1-hydroxy-2-(propan-2-ylamino)butyl]benzene-1,2-diol [1] |
SMILES | CCC(C(C1=CC(=C(C=C1)O)O)O)NC(C)C [1] |
InChI | InChI=1S/C13H21NO3/c1-4-10(14-8(2)3)13(17)9-5-6-11(15)12(16)7-9/h5-8,10,13-17H,4H2,1-3H3 [1] |
InChIKey | HUYWAWARQUIQLE-UHFFFAOYSA-N [1] |
Isoetarine
Isoetarine (also known as Isoetharine, Isoetarinum, Isoetarina, isoetharine, Isoetarin, Dilabron, Etyprenaline, Win 3406, Neoisuprel or Win-3406) is a sympathomimetic substance of the phenylethanolamine and catecholamine class.
Stereochemistry []
Isoetarine is a
Legal status
- Australia: Isoetarine is a S4 substance.
- United States: Isoetarine is a | IUPHAR_ligand = 7205 substance.