Harmaline
| Harmaline | |
|---|---|
| Molecular structure via molpic based on CDK |
| Rotamer [] | |
|---|---|
| Conformer structure via 3Dmol.js |
| Physical properties [] | |
|---|---|
| Molecular mass | 214.26 g/mol [1] |
| Appearance | Orthorhombic bipyramidal prisms, tablets from methanol, rhombic octahedra from ethanol [1] |
| Melting point | 229-231 °C [1] |
| Solubility | 30.6 [ug/mL] (The mean of the results at pH 7.4) [1] |
| Predicted LogP | 2.1 [1] |
| Structural Identifiers [] | |
|---|---|
| Molecular formula | C13H14N2O [1] |
| IUPAC name | 7-methoxy-1-methyl-4,9-dihydro-3H-pyrido[3,4-b]indole [1] |
| SMILES | CC1=NCCC2=C1NC3=C2C=CC(=C3)OC [1] |
| InChI | InChI=1S/C13H14N2O/c1-8-13-11(5-6-14-8)10-4-3-9(16-2)7-12(10)15-13/h3-4,7,15H,5-6H2,1-2H3 [1] |
| InChIKey | RERZNCLIYCABFS-UHFFFAOYSA-N [1] |
Harmaline (also known as Dihydroharmine, Harmidine, Armalin, 3,4-Dihydroharmine, Harmalol methyl ether, O-Methylharmalol, Harmine, dihydro-, 3H-Pyrido[3,4-b]indole, 4,9-dihydro-7-methoxy-1-methyl-, harmalin or 1-Methyl-7-methoxy-3,4-dihydro-beta-carboline) is a
Chemistry
Stereochemistry []
Harmaline is a achiral mixture