Etafedrine | |
---|---|
Molecular structure via molpic based on CDK |
Conformer [] | |
---|---|
Conformer structure via JSmol |
Physical properties [] | |
---|---|
Molecular mass | 193.28 g/mol [1] |
Melting point | 108-110 [1] |
Predicted LogP | 2.1 [1] |
Structural Identifiers [] | |
---|---|
Molecular formula | C12H19NO [1] |
IUPAC name | (1R,2S)-2-[ethyl(methyl)amino]-1-phenylpropan-1-ol [1] |
SMILES | CCN(C)[C@@H](C)[C@@H](C1=CC=CC=C1)O [1] |
InChI | InChI=1S/C12H19NO/c1-4-13(3)10(2)12(14)11-8-6-5-7-9-11/h5-10,12,14H,4H2,1-3H3/t10-,12-/m0/s1 [1] |
InChIKey | IRVLBORJKFZWMI-JQWIXIFHSA-N [1] |
Etafedrine
Etafedrine (also known as (-)-Etafedrine, (1r,2s)-2-[ethyl(methyl)amino]-1-phenylpropan-1-ol, 1-N-Ethylephedrine, Novedrin, (1R,2S)-N-Ethylephedrine, Etafedrine, (-)-, Menetryl, α-(1-(Ethylmethylamino)ethyl)benzyl alcohol, Etafedrina or Etafedrinum) is a sympathomimetic substance of the phenylethanolamine class.
Chemistry
Stereochemistry []
Etafedrine is a absolute mixture
Legal status
- Australia: Etafedrine is a S2 substance.
- Brazil: Etafedrine is a D1 substance.