Ephedrine
| Ephedrine | |
|---|---|
| Esters [] | |
|---|---|
| Ephedrine acetate | |
| Molecular structure via molpic based on CDK |
| Rotamer [] | |
|---|---|
| Conformer structure via 3Dmol.js |
| Physical properties [] | |
|---|---|
| Molecular mass | 165.23 g/mol [1] |
| Predicted LogP | 0.9 [1] |
| Structural Identifiers [] | |
|---|---|
| Molecular formula | C10H15NO [1] |
| IUPAC name | (1S,2R)-2-(methylamino)-1-phenylpropan-1-ol [1] |
| SMILES | C[C@H]([C@H](C1=CC=CC=C1)O)NC [1] |
| InChI | InChI=1S/C10H15NO/c1-8(11-2)10(12)9-6-4-3-5-7-9/h3-8,10-12H,1-2H3/t8-,10-/m1/s1 [1] |
| InChIKey | KWGRBVOPPLSCSI-PSASIEDQSA-N [1] |
| Dosing[] |
|---|
| Oral [] | |
|---|---|
| Threshold | 1 - 2 |
| Light | 2 - 10 |
| Common | 10 - 25 |
| Strong | 25 - 50 |
| Heavy | 50 - 75 |
Statistically derived dosages via DBI-IGS We do not take any responsibility for medical complications or loss of life sustained by following these dosages blindly. |
Ephedrine (also known as d-Ephedrine, (+)-Ephedrine, L-(+)-Ephedrine, racephedrine, (+)-Ephedrin, (+)-(1s,2r)-ephedrine, (+)-Ephedrine anhydrous, (+-)-Ephedrine, Ephedrine, (+)- or Racephedrine) is a sympathomimetic substance of the phenylethanolamine class.
Chemistry
Salts and Esters []
Ephedrine is typically found in the form of its hydrochloride, hemihydrate, sulfate and tartrate salts
or its acetate ester.
Stereochemistry []
(RS)-Ephedrine is a racemic mixture of the optical stereoisomers.