| RTI-111 | |
|---|---|
| Molecular structure via molpic based on CDK |
| Rotamer [] | |
|---|---|
| Conformer structure via 3Dmol.js |
| Physical properties [] | |
|---|---|
| Molecular mass | 314.2 g/mol [1] |
| Predicted LogP | 3.4 [1] |
| Structural Identifiers [] | |
|---|---|
| Molecular formula | C15H17Cl2NO2 [1] |
| IUPAC name | methyl (1R,2S,3S,5S)-3-(3,4-dichlorophenyl)-8-azabicyclo[3.2.1]octane-2-carboxylate [1] |
| SMILES | COC(=O)[C@@H]1[C@H]2CC[C@H](N2)C[C@@H]1C3=CC(=C(C=C3)Cl)Cl [1] |
| InChI | InChI=1S/C15H17Cl2NO2/c1-20-15(19)14-10(7-9-3-5-13(14)18-9)8-2-4-11(16)12(17)6-8/h2,4,6,9-10,13-14,18H,3,5,7H2,1H3/t9-,10+,13+,14-/m0/s1 [1] |
| InChIKey | JFUNLJPTPCQLIR-PJQZNRQZSA-N [1] |
Dichloropane
Dichloropane (also known as 2-Carbomethoxy-3-(3,4-dichlorophenyl)tropane, Cdct cpd, 8-Azabicyclo(3.2.1)octane-2-carboxylic acid, 3-(3,4-dichlorophenyl)-, methyl ester, (1R-(exo,exo))-, MFZ 2-13, O-456 or 8-Azabicyclo(3.2.1)octane-2-carboxylic acid, 3-(3,4-dichlorophenyl)-, methyl ester, (1r,2s,3s,5s)-) is a stimulant substance of the piperidine class.
Chemistry
Stereochemistry []
Dichloropane is a absolute mixture
Legal status []
- United Kingdom: Dichloropane is a PSA | legal_US = Schedule II substance.