Anodyne| Capsaicin | |
|---|---|
 | |
| Esters [] | |
|---|---|
| Capsaicin palmitate | |
|
| Molecular structure via molpic based on CDK |
| Conformer [] | |
|---|---|
| Conformer structure via JSmol | |
| Physical properties [] | |
|---|---|
| Molecular mass | 305.4 g/mol [1] |
| Appearance | Pure dark red solid [1] |
| Odor | Highly volatile with a pungent odor [1] |
| Taste | Burning taste detectable in 1 part in 100,000 [1] |
| Melting point | 65 °C [1] |
| Boiling point | 210-220 [1] |
| Decomposition | When heated to decomposition it emits toxic fumes of /nitrogen oxides/. [1] |
| Solubility | Insoluble in cold water [1] |
| Predicted LogP | 3.6 [1] |
| Structural Identifiers [] | |
|---|---|
| Molecular formula | C18H27NO3 [1] |
| IUPAC name | (E)-N-[(4-hydroxy-3-methoxyphenyl)methyl]-8-methylnon-6-enamide [1] |
| SMILES | CC(C)/C=C/CCCCC(=O)NCC1=CC(=C(C=C1)O)OC [1] |
| InChI | InChI=1S/C18H27NO3/c1-14(2)8-6-4-5-7-9-18(21)19-13-15-10-11-16(20)17(12-15)22-3/h6,8,10-12,14,20H,4-5,7,9,13H2,1-3H3,(H,19,21)/b8-6+ [1] |
| InChIKey | YKPUWZUDDOIDPM-SOFGYWHQSA-N [1] |
Capsaicin
Capsaicin (also known as CAPSAICINE, Qutenza, trans-Capsaicin, Styptysat, Isodecenoic acid vanillylamide, Ausanil, Mioton, FEMA No. 3404, Dolenon or Ovocap) is a
Chemistry
Esters []
Capsaicin is typically found in the form of its ester.
Stereochemistry []
Capsaicin is a achiral mixture