Bretisilocin
| 5-Fluoro-MET | |
|---|---|
| Molecular structure via molpic based on CDK |
| Physical properties [] | |
|---|---|
| Molecular mass | 220.29 g/mol [1] |
| Predicted LogP | 2 [1] |
| Structural Identifiers [] | |
|---|---|
| Molecular formula | C13H17FN2 [1] |
| IUPAC name | N-ethyl-2-(5-fluoro-1H-indol-3-yl)-N-methylethanamine [1] |
| SMILES | CCN(C)CCC1=CNC2=C1C=C(C=C2)F [1] |
| InChI | InChI=1S/C13H17FN2/c1-3-16(2)7-6-10-9-15-13-5-4-11(14)8-12(10)13/h4-5,8-9,15H,3,6-7H2,1-2H3 [1] |
| InChIKey | XRWQULAXCLVBPP-UHFFFAOYSA-N [1] |
| Pharmacokinetics[] | |
|---|---|
| Elimination half-life | 45 minutes |
| Duration of action | 60–90 minutes |
Bretisilocin (also known as 5-Fluoro-N-methyl-N-ethyltryptamine, US20240286998, Compound 12, N-Ethyl-5-fluoro-N-methyl-1H-indole-3-ethanamine, 1H-Indole-3-ethanamine, N-ethyl-5-fluoro-N-methyl-, N-ethyl-2-(5-fluoro-1H-indol-3-yl)-N- methylethan-1-amine or N-ethyl-2-(5-fluoro-1H-indol-3-yl)-N-methylethan-1-amine) is a psychedelic substance of the tryptamine class.
Stereochemistry []
Bretisilocin is a