| BPS | |
|---|---|
| Molecular structure via molpic based on CDK |
| Rotamer [] | |
|---|---|
| Conformer structure via 3Dmol.js |
| Physical properties [] | |
|---|---|
| Molecular mass | 250.27 g/mol [1] |
| Density | 1.3663 g/cu cm at 15 °C g/cm3 [1] |
| Appearance | White, crystalline powder [1] |
| Melting point | 240.5 °C [1] |
| Decomposition | When heated to decomposition it emits toxic fumes of Sulfur oxides. [1] |
| Solubility | Insoluble in water [1] |
| Predicted LogP | 1.9 [1] |
| Structural Identifiers [] | |
|---|---|
| Molecular formula | C12H10O4S [1] |
| IUPAC name | 4-(4-hydroxyphenyl)sulfonylphenol [1] |
| SMILES | C1=CC(=CC=C1O)S(=O)(=O)C2=CC=C(C=C2)O [1] |
| InChI | InChI=1S/C12H10O4S/c13-9-1-5-11(6-2-9)17(15,16)12-7-3-10(14)4-8-12/h1-8,13-14H [1] |
| InChIKey | VPWNQTHUCYMVMZ-UHFFFAOYSA-N [1] |
Bisphenol S
(Redirected from Bisphenol S)Bisphenol S (also known as 4,4'-Sulfonyldiphenol, Bis(4-hydroxyphenyl) sulfone, Phenol, 4,4'-sulfonylbis-, 4,4'-Dihydroxydiphenyl sulfone, 4-Hydroxyphenyl sulfone, 4,4'-Sulfonylbisphenol, Bis(p-hydroxyphenyl) sulfone, Diphone C, Bis(4-hydroxyphenyl)sulfone or 4,4-Sulfonyldiphenol) is a
Chemistry
Stereochemistry []
Bisphenol S is a achiral mixture
Anodyne