Anodyne| Amlodipine | |
|---|---|
 | |
| Esters [] | |
|---|---|
| Amlodipine benzoate | |
|
| Molecular structure via molpic based on CDK |
| Physical properties [] | |
|---|---|
| Molecular mass | 408.9 g/mol [1] |
| Melting point | 199-201 [1] |
| Decomposition | Hazardous decomposition products formed under fire conditions - Carbon oxides, nitrogen oxides (NOx), sulfur oxides, hydrogen chloride gas. /Amlodipine besylate/ [1] |
| Solubility | slightly soluble in water [1] |
| Predicted LogP | 3 [1] |
| Structural Identifiers [] | |
|---|---|
| Molecular formula | C20H25ClN2O5 [1] |
| IUPAC name | 3-O-ethyl 5-O-methyl 2-(2-aminoethoxymethyl)-4-(2-chlorophenyl)-6-methyl-1,4-dihydropyridine-3,5-dicarboxylate [1] |
| SMILES | CCOC(=O)C1=C(NC(=C(C1C2=CC=CC=C2Cl)C(=O)OC)C)COCCN [1] |
| InChI | InChI=1S/C20H25ClN2O5/c1-4-28-20(25)18-15(11-27-10-9-22)23-12(2)16(19(24)26-3)17(18)13-7-5-6-8-14(13)21/h5-8,17,23H,4,9-11,22H2,1-3H3 [1] |
| InChIKey | HTIQEAQVCYTUBX-UHFFFAOYSA-N [1] |
| Dosing [] | |
|---|---|
| Elimination half-life | 30–50 hours |
| Duration of action | At least 24 hours |
Amlodipine
Amlodipine (also known as Amlocard, Amlodipino, Coroval, Lipinox, Amlodipinum, Amlodipine Free Base, 3-ethyl 5-methyl 2-((2-aminoethoxy)methyl)-4-(2-chlorophenyl)-6-methyl-1,4-dihydropyridine-3,5-dicarboxylate, HGP0904, UK-4834011 or HGP-0904)
Chemistry
Salts and Esters []
Stereochemistry []
(RS)-Amlodipine is a racemic mixture of the optical stereoisomers
| Anodyne Usernotes [] | |
|---|---|
| 0xea / Amlodipine[besylate] via | Nothing to Note |
Legal status
- Australia: Amlodipine is a S4 substance.
- Canada: Amlodipine is a prescription only substance.
- United Kingdom: Amlodipine is a prescription only substance.
- United States: Amlodipine is a prescription only substance.
- European Union: Amlodipine is a prescription only substance.