Anodyne| 6-MAM | |
|---|---|
 | |
| Molecular structure via molpic based on CDK |
| Physical properties [] | |
|---|---|
| Molecular mass | 327.4 g/mol [1] |
| Predicted LogP | 1.3 [1] |
| Structural Identifiers [] | |
|---|---|
| Molecular formula | C19H21NO4 [1] |
| IUPAC name | (9-hydroxy-3-methyl-2,4,4a,7,7a,13-hexahydro-1H-4,12-methanobenzofuro[3,2-e]isoquinolin-7-yl) acetate [1] |
| SMILES | CC(=O)OC1C=CC2C3CC4=C5C2(C1OC5=C(C=C4)O)CCN3C [1] |
| SMILES | O=C(C)OC1C=CC2C3N(C)CCC42C5=C(OC14)C(O)=CC=C5C3 [1] |
| InChI | InChI=1S/C19H21NO4/c1-10(21)23-15-6-4-12-13-9-11-3-5-14(22)17-16(11)19(12,18(15)24-17)7-8-20(13)2/h3-6,12-13,15,18,22H,7-9H2,1-2H3 [1] |
| InChIKey | JJGYGPZNTOPXGV-UHFFFAOYSA-N [1] |
| Dosing [] | |
|---|---|
| Elimination half-life | < 5 mins |
6-Monoacetylmorphine
6-Monoacetylmorphine (also known as O6 Monoacetylmorphine, Monoacetylmorphine, Morphinan-3,6-.α.-diol, 7,8-didehydro-4,5-.α.-epoxy-17-methyl-, 6-acetate, a-Monoacetyl-Morphine, CGA47790, 7,8-Didehydro-4,5.α.-epoxy-17-methylmorphinan-3,6.α.-diol 6-acetate or Morphinan-3,6-diol, 7,8-didehydro-4,5-epoxy-17-methyl-, (5.α.,6.α.)-, 6-acetate) is a
Stereochemistry []
6-Monoacetylmorphine is a
| Anodyne Usernotes [] | |
|---|---|
| 0xea / 6-Monoacetylmorphine[citrate] via | obtained by letting Diacetylmorphine sit in a low pH solution for several weeks; quite potent; relaxing to the point of inducing sleep; warm; minor pain reduction; helps deal with siginificant emotional pain; weird dream like states which feel fully concious; encourages sexuality |
Legal status
- Australia: 6-Monoacetylmorphine is a S9 substance.
- United Kingdom: 6-Monoacetylmorphine is a Class A substance.