Anodyne| 5-APB | |
|---|---|
 |
| Salts [] | |
|---|---|
| 5-APB hydrochloride | |
|
| Molecular structure via molpic | |
| Conformer structure via 3Dmol.js | |
| Molecular formula | C11H13NO[1] |
|---|---|
| Molecular mass | 175.23 g/mol[1] |
| Predicted LogP | 2.1[1] |
| Chirality | racemic[2] |
| Identifiers [] | |
|---|---|
| IUPAC name | 1-(1-benzofuran-5-yl)propan-2-amine[1] |
| SMILES | CC(CC1=CC2=C(C=C1)OC=C2)N[1] |
| InChI | InChI=1S/C11H13NO/c1-8(12)6-9-2-3-11-10(7-9)4-5-13-11/h2-5,7-8H,6,12H2,1H3[1] |
| InChIKey | VKUMKUZDZWHMQU-UHFFFAOYSA-N[1] |
| Dosing |
|---|
5-APB
5-APB (also known as 5-(2-Aminopropyl)benzofuran, 1-(Benzofuran-5-yl)propan-2-amine, 5-Benzofuranethanamine, α-methyl-, α-Methyl-5-benzofuranethanamine, vkumkuzdzwhmqu-uhfffaoysa-n, 1-(benzofur-5-yl)-2-aminopropane or 1-(1-benzouran-5-yl)propan-2-amine) is a substance of the amphetamine class.
Chemistry
5-APB is typically found in the form of its hydrochloride salt.
Stereochemistry
(RS)-5-APB is a racemic mixture of the optical stereoisomers
Legal status
- Australia: 5-APB is a S9 substance.
- Brazil: 5-APB is a F2 substance.
- United Kingdom: 5-APB is a Class B substance.
- Germany: 5-APB is a Anlage II substance.
- United Nations: 5-APB is a Unscheduled. substance.