Anodyne| 3-MEC | |
|---|---|
 | |
| Molecular structure via molpic based on CDK |
| Physical properties [] | |
|---|---|
| Molecular mass | 191.27 g/mol [1] |
| Predicted LogP | 2.3 [1] |
| Structural Identifiers [] | |
|---|---|
| Molecular formula | C12H17NO [1] |
| IUPAC name | 2-(ethylamino)-1-(3-methylphenyl)propan-1-one [1] |
| SMILES | CCNC(C)C(=O)C1=CC=CC(=C1)C [1] |
| InChI | InChI=1S/C12H17NO/c1-4-13-10(3)12(14)11-7-5-6-9(2)8-11/h5-8,10,13H,4H2,1-3H3 [1] |
| InChIKey | GEKLDGQKEZAPFZ-UHFFFAOYSA-N [1] |
3-Methylethcathinone
3-Methylethcathinone (also known as 3-Mec, 2-(Ethylamino)-1-(3-methylphenyl)propan-1-one, gekldgqkezapfz-uhfffaoysa-n, 2-(ethylamino)-1-(3-methylphenyl)-1-Propanone, PHC43983 or 2-(ethylamino)-1-(3-methylphenyl)-1-Propanone; 1-Propanone, 2-(ethylamino)-1-(3-methylphenyl)-; 2-(Ethylamino)-1-(3-methylphenyl)-1-propanone; 3-Methylethcathinone; 2-(Ethylamino)-1-(m-tolyl)propan-1-one) is a
Chemistry
Salts []
3-Methylethcathinone is typically found in the form of its hydrochloride salt.
Stereochemistry []
(RS)-3-Methylethcathinone is a racemic mixture of the optical stereoisomers
| Anodyne Usernotes [] | |
|---|---|
| 0xea / 3-Methylethcathinone[hydrochloride] via Insufflated and Intravenous | Moderate Stimulation and Euphoria; Moderate Duration; instant Gag Reflex Induced upon Injection; Potencial Serotonin syndrome risk |